Datasheets » refractive index of selected substances
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
ethyl trifluoroacetate | Ethyl trifluoroacetate | C4H5F3O2 | 1.306 |
InChI=1/C4H5F3O2/c1-2-9-3(8)4(5,6)7/h2H2,1H3 | |||
FC(F)(F)C(=O)OCC | |||
methanol | Methyl alcohol | CH4O | 1.329 |
InChI=1/CH4O/c1-2/h2H,1H3 | |||
CO | |||
acetaldehyde | Acetaldehyde | C2H4O | 1.3316 |
InChI=1/C2H4O/c1-2-3/h2H,1H3 | |||
CC=O | |||
difluoroacetic acid | Difluoroacetic acid | C2H2F2O2 | 1.3419 |
InChI=1/C2H2F2O2/c3-1(4)2(5)6/h1H,(H,5,6) | |||
FC(F)C(=O)O | |||
methyl formate | Methyl formate | C2H4O2 | 1.344 |
InChI=1/C2H4O2/c1-4-2-3/h2H,1H3 | |||
O=COC | |||
acetonitrile | Acetonitrile | C2H3N | 1.3474 |
InChI=1/C2H3N/c1-2-3/h1H3 | |||
CC#N | |||
diethyl ether | Ether | C4H10O | 1.3526 |
InChI=1/C4H10O/c1-3-5-4-2/h3-4H2,1-2H3 | |||
CCOCC | |||
dimethoxymethane | Methylal | C3H8O2 | 1.3534 |
InChI=1/C3H8O2/c1-4-3-5-2/h3H2,1-2H3 | |||
COCOC | |||
2-methylbutane | 2-Methylbutane (Isopentane) | C5H12 | 1.355 |
InChI=1/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3 | |||
CC(C)CC | |||
pentane | n-Pentane | C5H12 | 1.3564 |
InChI=1/C5H12/c1-3-5-4-2/h3-5H2,1-2H3 | |||
CCCCC | |||
1-fluoropentane | n-Amyl fluoride | C5H11F | 1.3574 |
InChI=1/C5H11F/c1-2-3-4-5-6/h2-5H2,1H3 | |||
CCCCCF | |||
2-methoxypropane | Methyl isopropyl ether | C4H10O | 1.3576 |
InChI=1/C4H10O/c1-4(2)5-3/h4H,1-3H3 | |||
CC(C)OC | |||
1-methoxypropane | Methyl propyl ether | C4H10O | 1.3579 |
InChI=1/C4H10O/c1-3-4-5-2/h3-4H2,1-2H3 | |||
CCCOC | |||
propan-2-one | Acetone | C3H6O | 1.3591 |
InChI=1/C3H6O/c1-3(2)4/h1-2H3 | |||
CC(C)=O | |||
ethyl formate | Ethyl formate | C3H6O2 | 1.3597 |
InChI=1/C3H6O2/c1-2-5-3-4/h3H,2H2,1H3 | |||
O=COCC | |||
propyl nitrite | Propyl nitrite | C3H7NO2 | 1.3613 |
InChI=1/C3H7NO2/c1-2-3-6-4-5/h2-3H2,1H3 | |||
CCCON=O | |||
ethanol | Ethyl alcohol | C2H6O | 1.361 |
InChI=1/C2H6O/c1-2-3/h3H,2H2,1H3 | |||
CCO | |||
methyl acetate | Methyl acetate | C3H6O2 | 1.3619 |
InChI=1/C3H6O2/c1-3(4)5-2/h1-2H3 | |||
CC(=O)OC | |||
ethyl isocyanide | Ethyl isocyanide | C3H5N | 1.363 |
InChI=1/C3H5N/c1-3-4-2/h3H2,1H3 | |||
[C-]#[N+]CC | |||
propanal | Propionaldehyde | C3H6O | 1.3636 |
InChI=1/C3H6O/c1-2-3-4/h3H,2H2,1H3 | |||
CCC=O | |||
2-fluoroethanol | 2-Fluoroethyl alcohol | C2H5FO | 1.3639 |
InChI=1/C2H5FO/c3-1-2-4/h4H,1-2H2 | |||
FCCO | |||
propanenitrile | Propionitrile | C3H5N | 1.3664 |
InChI=1/C3H5N/c1-2-3-4/h2H2,1H3 | |||
CCC#N | |||
2,2-dimethylbutane | 2,2-Dimethylbutane | C6H14 | 1.369 |
InChI=1/C6H14/c1-5-6(2,3)4/h5H2,1-4H3 | |||
CC(C)(C)CC | |||
1-ethoxypropane | Ethyl propyl ether | C5H12O | 1.3695 |
InChI=1/C5H12O/c1-3-5-6-4-2/h3-5H2,1-2H3 | |||
CCOCCC |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
formic acid | Formic acid | CH2O2 | 1.3714 |
InChI=1/CH2O2/c2-1-3/h1H,(H,2,3) | |||
O=CO | |||
acetic acid | Acetic acid | C2H4O2 | 1.3719 |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) | |||
CC(=O)O | |||
2-methylpentane | 2-Methylpentane | C6H14 | 1.372 |
InChI=1/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3 | |||
CC(C)CCC | |||
2-methylpropyl nitrite | Isobutyl nitrite | C4H9NO2 | 1.3723 |
InChI=1/C4H9NO2/c1-4(2)3-7-5-6/h4H,3H2,1-2H3 | |||
CC(C)CON=O | |||
ethyl acetate | Ethyl acetate | C4H8O2 | 1.3727 |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 | |||
CC(=O)OCC | |||
2-methylpropanal | Isobutyraldehyde | C4H8O | 1.3730 |
InChI=1/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 | |||
CC(C)C=O | |||
pent-1-ene | n-Propylethylene | C5H10 | 1.3758 |
InChI=1/C5H10/c1-3-5-4-2/h3H,1,4-5H2,2H3 | |||
CCCC=C | |||
hexane | n-Hexane | C6H14 | 1.376 |
InChI=1/C6H14/c1-3-5-6-4-2/h3-6H2,1-2H3 | |||
CCCCCC | |||
ethyl fluoroacetate | Ethyl fluoroacetate | C4H7FO2 | 1.3767 |
InChI=1/C4H7FO2/c1-2-7-4(6)3-5/h2-3H2,1H3 | |||
FCC(=O)OCC | |||
3-methylpentane | 3-Methylpentane | C6H14 | 1.377 |
InChI=1/C6H14/c1-4-6(3)5-2/h6H,4-5H2,1-3H3 | |||
CC(CC)CC | |||
propyl formate | n-Propyl formate | C4H8O2 | 1.3771 |
InChI=1/C4H8O2/c1-2-3-6-4-5/h4H,2-3H2,1H3 | |||
O=COCCC | |||
methyl propanoate | Methyl propionate | C4H8O2 | 1.3779 |
InChI=1/C4H8O2/c1-3-4(5)6-2/h3H2,1-2H3 | |||
CCC(=O)OC | |||
propan-2-ol | Isopropyl alcohol | C3H8O | 1.378 |
InChI=1/C3H8O/c1-3(2)4/h3-4H,1-2H3 | |||
CC(C)O | |||
2,3-dimethylbutane | Diisopropyl | C6H14 | 1.3783 |
InChI=1/C6H14/c1-5(2)6(3)4/h5-6H,1-4H3 | |||
CC(C)C(C)C | |||
2-methylpropan-2-amine | tert.-Butylamine | C4H11N | 1.3786 |
InChI=1/C4H11N/c1-4(2,3)5/h5H2,1-3H3 | |||
CC(C)(C)N | |||
butan-2-one | Methyl ethyl ketone | C4H8O | 1.3791 |
InChI=1/C4H8O/c1-3-4(2)5/h3H2,1-2H3 | |||
CC(=O)CC | |||
1-propoxypropane | Propyl ether | C6H14O | 1.3807 |
InChI=1/C6H14O/c1-3-5-7-6-4-2/h3-6H2,1-2H3 | |||
CCCOCCC | |||
1,1-diethoxyethane | Acetal | C6H14O2 | 1.3819 |
InChI=1/C6H14O2/c1-4-7-6(3)8-5-2/h6H,4-5H2,1-3H3 | |||
CC(OCC)OCC | |||
nitromethane | Nitromethane | CH3NO2 | 1.382 |
InChI=1/CH3NO2/c1-2(3)4/h1H3 | |||
CN(=O)=O | |||
hex-1-ene | Butylethylene | C6H12 | 1.3821 |
InChI=1/C6H12/c1-3-5-6-4-2/h3H,1,4-6H2,2H3 | |||
C=CCCCC | |||
2,4-dimethylpentane | 2,4-Dimethylpentane | C7H16 | 1.3825 |
InChI=1/C7H16/c1-6(2)5-7(3)4/h6-7H,5H2,1-4H3 | |||
CC(C)CC(C)C | |||
ethanedial | Glyoxal | C2H2O2 | 1.3828 |
InChI=1/C2H2O2/c3-1-2-4/h1-2H | |||
O=CC=O | |||
butanenitrile | Butyronitrile | C4H7N | 1.383 |
InChI=1/C4H7N/c1-2-3-4-5/h2-3H2,1H3 | |||
CCCC#N | |||
d-sec.-Butyl formate | C6H10O2 | 1.384 | |
Methyl isobutyrate | (CH3)2CHCO2CH3 | 1.3840 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
n-Butyraldehyde | C3H7CHO | 1.3843 | |
Ethyl propionate | C2H5CO2C2H5 | 1.3844 | |
n-Propyl acetate | CH3CO2C3H7 | 1.3844 | |
Methyl n-amyl ether | C5H11OCH3 | 1.3849 | |
ethyl nitrate | Ethyl nitrate | C2H5NO3 | 1.385 |
InChI=1/C2H5NO3/c1-2-6-3(4)5/h2H2,1H3 | |||
O=N(=O)OCC | |||
n-Heptane | CH3(CH2)5CH3 | 1.385 | |
n-Amyl nitrite | CH3(CH2)4ONO | 1.3851 | |
Diethyl carbonate | (C2H6O)2CO | 1.3852 | |
2-methylpropyl formate | Isobutyl formate | C5H10O2 | 1.3858 |
InChI=1/C5H10O2/c1-5(2)3-7-4-6/h4-5H,3H2,1-2H3 | |||
CC(C)COC=O | |||
propan-1-ol | n-Propyl alcohol | C3H8O | 1.386 |
InChI=1/C3H8O/c1-2-3-4/h4H,2-3H2,1H3 | |||
CCCO | |||
2-chloro-2-methylpropane | tert.-Butyl chloride | C4H9Cl | 1.386 |
InChI=1/C4H9Cl/c1-4(2,3)5/h1-3H3 | |||
CC(C)(C)Cl | |||
1-fluoroheptane | n-Heptyl fluoride | C7H15F | 1.3861 |
InChI=1/C7H15F/c1-2-3-4-5-6-7-8/h2-7H2,1H3 | |||
CCCCCCCF | |||
3-methylbutan-2-one | Methyl isopropyl ketone | C5H10O | 1.3862 |
InChI=1/C5H10O/c1-4(2)5(3)6/h4H,1-3H3 | |||
CC(C)C(C)=O | |||
propanoic acid | Propionic acid | C3H6O2 | 1.3868 |
InChI=1/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) | |||
CCC(=O)O | |||
2-methylpropan-2-ol | Butyl alcohol | C4H10O | 1.387 |
InChI=1/C4H10O/c1-4(2,3)5/h5H,1-3H3 | |||
CC(C)(C)O | |||
N-ethylethanamine | Diethylamine | C4H11N | 1.387 |
InChI=1/C4H11N/c1-3-5-4-2/h5H,3-4H2,1-2H3 | |||
CCNCC | |||
dimethyl sulfate | Methyl sulfate | C2H6O4S | 1.3874 |
InChI=1/C2H6O4S/c1-5-7(3,4)6-2/h1-2H3 | |||
O=S(=O)(OC)OC | |||
Isoamyl nitrite | (CH3)2CH(CH2)2ONO | 1.3874 | |
Methyl n-butyrate | C3H7CO2CH3 | 1.3879 | |
Ethyl allyl ether | C2H5OCH2CHCH2 | 1.3881 | |
n-Valeric aldehyde | C4H9CHO | 1.3882 | |
1-chloropropane | n-Propyl chloride | C3H7Cl | 1.3886 |
InChI=1/C3H7Cl/c1-2-3-4/h2-3H2,1H3 | |||
CCCCl | |||
propan-1-amine | n-Propylamine | C3H9N | 1.389 |
InChI=1/C3H9N/c1-2-3-4/h2-4H2,1H3 | |||
CCCN | |||
butan-2-yl acetate | sec.-Butyl acetate | C6H12O2 | 1.389 |
InChI=1/C6H12O2/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 | |||
CC(=O)OC(C)CC | |||
butyl formate | n-Butyl formate | C5H10O2 | 1.3891 |
InChI=1/C5H10O2/c1-2-3-4-7-5-6/h5H,2-4H2,1H3 | |||
O=COCCCC |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
pentan-2-one | Methyl propyl ketone | C5H10O | 1.3895 |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-4H2,1-2H3 | |||
CC(=O)CCC | |||
acetyl chloride | Acetyl chloride | C2H3ClO | 1.3898 |
InChI=1/C2H3ClO/c1-2(3)4/h1H3 | |||
CC(Cl)=O | |||
2,2,3-trimethylbutane | 2,2,3-Trimethylbutane | C7H16 | 1.390 |
InChI=1/C7H16/c1-6(2)7(3,4)5/h6H,1-5H3 | |||
CC(C)C(C)(C)C | |||
diethyl sulfate | Diethyl sulfate | C4H10O4S | 1.3902 |
InChI=1/C4H10O4S/c1-3-7-9(5,6)8-4-2/h3-4H2,1-2H3 | |||
O=S(=O)(OCC)OCC | |||
3-methylbutanal | Isovaleraldehyde | C5H10O | 1.3902 |
InChI=1/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 | |||
CC(C)CC=O | |||
ethyl 2-methylpropanoate | Ethyl isobutyrate | C6H12O2 | 1.3903 |
InChI=1/C6H12O2/c1-4-8-6(7)5(2)3/h5H,4H2,1-3H3 | |||
CC(C)C(=O)OCC | |||
acetic anhydride | Acetic anhydride | C4H6O3 | 1.3904 |
InChI=1/C4H6O3/c1-3(5)7-4(2)6/h1-2H3 | |||
CC(=O)OC(C)=O | |||
n-Valeryl nitrile | C4H9CN | 1.3909 | |
Isoamyl formate | C6H12O2 | 1.391 | |
Nitroethane | CH3CH2NO2 | 1.392 | |
Diacetyl | CH3COCOCH3 | 1.3927 | |
Diethyl ketone | (C2H5)2CO | 1.3927 | |
2,5-Dimethylhexane | C8H18 | 1.3929 | |
Isobutyric acid | (CH3)2CHCO2H | 1.3930 | |
3-Ethylpentane | (C2H5)3CH | 1.393 | |
Ethyl orthocarbonate | C(OC2H5)4 | 1.393 | |
Ethyl n-butyrate | C3H7CO2C2H5 | 1.3932 | |
n-Propyl propionate | C2H5CO2C3H7 | 1.3935 | |
sec.-Butylamine | C2H5CH(NH2)CH3 | 1.394 | |
n-Octyl fluoride | CH3(CH2)6CH2F | 1.3947 | |
n-Butyl acetate | CH3CO2C4H9 | 1.3951 | |
Methyl isobutyl ketone | C6H12O | 1.3959 | |
Propyl isobutyrate | (CH3)2CHCO2C3H7 | 1.3959 | |
Isobutyl chloride | (CH3)2CHCH2Cl | 1.3960 | |
Isobutyl alcohol | (CH3)2CHCH2OH | 1.396 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
d-β-Amyl acetate | C7H14O2 | 1.3960 | |
Ethylacetylene | C2H5CCH | 1.3962 | |
Ethylethylene | C2H5CHCH2 | 1.3962 | |
Isooctane | (CH3)2CH(CH2)4CH3 | 1.3964 | |
sec.-Butyl alcohol | C2H5CH(OH)CH3 | 1.397 | |
Propyl nitrate | C3H7ONO2 | 1.3972 | |
d-Methyl isopropyl carbinol | C6H12O | 1.3973 | |
Chloromethyl methyl ether | C2H6ClO | 1.3974 | |
Isobutyl propionate | C7H14O2 | 1.3975 | |
butanoic acid | n-Butyric acid | C4H8O2 | 1.3979 |
InChI=1/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6) | |||
CCCC(=O)O | |||
2-chlorobutane | sec.-Butyl chloride | C4H9Cl | 1.398 |
InChI=1/C4H9Cl/c1-3-4(2)5/h4H,3H2,1-2H3 | |||
CC(Cl)CC | |||
2-methylpropan-1-amine | Isobutylamine | C4H11N | 1.398 |
InChI=1/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3 | |||
CC(C)CN | |||
octane | n-Octane | C8H18 | 1.3980 |
InChI=1/C8H18/c1-3-5-7-8-6-4-2/h3-8H2,1-2H3 | |||
CCCCCCCC | |||
methyl prop-2-enoate | Methyl acrylate | C4H6O2 | 1.3984 |
InChI=1/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 | |||
C=CC(=O)OC | |||
4-methylheptane | 4-Methylheptane | C8H18 | 1.398 |
InChI=1/C8H18/c1-4-6-8(3)7-5-2/h8H,4-7H2,1-3H3 | |||
CC(CCC)CCC | |||
3-methylpentan-2-one | Methyl sec.-butyl ketone | C6H12O | 1.399 |
InChI=1/C6H12O/c1-4-5(2)6(3)7/h5H,4H2,1-3H3 | |||
CC(CC)C(C)=O | |||
butan-1-ol | n-Butyl alcohol | C4H10O | 1.3993 |
InChI=1/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3 | |||
CCCCO | |||
2-hydroxy-2-methylpropanenitrile | Acetonecyanhydrin | C4H7NO | 1.3996 |
InChI=1/C4H7NO/c1-4(2,6)3-5/h6H,1-2H3 | |||
N#CC(C)(C)O | |||
2-methylpropyl acetate | Isobutyl acetate | C6H12O2 | 1.3997 |
InChI=1/C6H12O2/c1-5(2)4-8-6(3)7/h5H,4H2,1-3H3 | |||
CC(=O)OCC(C)C | |||
prop-2-enal | Acrolein | C3H4O | 1.3998 |
InChI=1/C3H4O/c1-2-3-4/h2-3H,1H2 | |||
C=CC=O | |||
2-methylpropyl 2-methylpropanoate | Isobutyl isobutyrate | C8H16O2 | 1.3999 |
InChI=1/C8H16O2/c1-6(2)5-10-8(9)7(3)4/h6-7H,5H2,1-4H3 | |||
CC(C)C(=O)OCC(C)C | |||
pent-2-yne | Methylethylacetylene | C5H8 | 1.4004 |
InChI=1/C5H8/c1-3-5-4-2/h3H2,1-2H3 | |||
CC#CCC | |||
3-methylbutyl acetate | Isoamyl acetate | C7H14O2 | 1.4005 |
InChI=1/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 | |||
CC(=O)OCCC(C)C | |||
propyl butanoate | Propyl n-butyrate | C7H14O2 | 1.4005 |
InChI=1/C7H14O2/c1-3-5-7(8)9-6-4-2/h3-6H2,1-2H3 | |||
CCCC(=O)OCCC | |||
hexan-3-one | Ethyl propyl ketone | C6H12O | 1.4006 |
InChI=1/C6H12O/c1-3-5-6(7)4-2/h3-5H2,1-2H3 | |||
CCC(=O)CCC |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Isobutyl-d-amyl ether | C9H20O | 1.4008 | |
Ethyl isovalerate | C7H14O2 | 1.4009 | |
1,5-Hexadiene | (CH2CHCH2)2 | 1.4010 | |
3-Methyl-2-pentene (isomer 2) | C6H12 | 1.401 | |
N,N-diethylethanamine | Triethylamine | C6H15N | 1.401 |
InChI=1/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3 | |||
CCN(CC)CC | |||
n-Amyl acetate | CH3CO2C5H11 | 1.4012 | |
butan-1-amine | n-Butylamine | C4H11N | 1.401 |
InChI=1/C4H11N/c1-2-3-4-5/h2-5H2,1H3 | |||
CCCCN | |||
1-chlorobutane | n-Butyl chloride | C4H9Cl | 1.4015 |
InChI=1/C4H9Cl/c1-2-3-4-5/h2-4H2,1H3 | |||
CCCCCl | |||
d-β-Amyl propionate | C8H16O2 | 1.4015 | |
2-Methyl-3-ethylpentane | C8H18 | 1.4016 | |
2-Ethylhexane | CH3(C2H5)CHC4H9 | 1.402 | |
1-Nitropropane | C2H5CH2NO2 | 1.4022 | |
Isobutyl nitrate | (CH3)2CHCH2ONO2 | 1.4026 | |
2,4-Dimethylhexane | C8H18 | 1.4026 | |
d-β-Hexyl acetate | C8H16O2 | 1.4030 | |
Isobutyl n-butyrate | C8H16O2 | 1.4035 | |
n-Propyl isovalerate | C8H16O2 | 1.4036 | |
Propionic anhydride | (CH3CH2CO)2O | 1.4038 | |
2,4-Dimethylheptane | C9H20 | 1.404 | |
dl-2,5-Dimethylheptane | C9H20 | 1.4040 | |
Isovaleric acid | (CH3)2CHCH2CO2H | 1.4043 | |
Allyl acetate | CH3CO2C3H5 | 1.4045 | |
4-Methyloctane | C3H7(CH3)CHC4H9 | 1.4047 | |
Butyl n-butyrate | C3H7CO2C4H9 | 1.4049 | |
N-propylpropan-1-amine | Di-n-propylamine | C6H15N | 1.405 |
InChI=1/C6H15N/c1-3-5-7-6-4-2/h7H,3-6H2,1-2H3 | |||
CCCNCCC |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
triethyl phosphate | Triethyl phosphate | C6H15O4P | 1.405 |
InChI=1/C6H15O4P/c1-4-8-11(7,9-5-2)10-6-3/h4-6H2,1-3H3 | |||
CCOP(=O)(OCC)OCC | |||
nonane | n-Nonane | C9H20 | 1.405 |
InChI=1/C9H20/c1-3-5-7-9-8-6-4-2/h3-9H2,1-2H3 | |||
CCCCCCCCC | |||
propanoyl chloride | Propionyl chloride | C3H5ClO | 1.4051 |
InChI=1/C3H5ClO/c1-2-3(4)5/h2H2,1H3 | |||
CCC(Cl)=O | |||
dl-Methylethylacetic acid | C6H10O2 | 1.4051 | |
d-sec.-Amyl alcohol | C6H12O | 1.4053 | |
Amyl chloride | (CH3)2(C2H5)CCl | 1.4056 | |
3,4-Dimethylhexane | C8H18 | 1.4058 | |
sec.-Amyl chloride | C3H7(CH3)CHCl | 1.4060 | |
Amyl alcohol | (CH3)2(C2H5)COH | 1.406 | |
Isocapronitrile | (CH3)2CH(CH2)2CN | 1.406 | |
n-Amylacetylene | C6H11CCH | 1.406 | |
d-β-Amyl n-butyrate | C9H18O2 | 1.4060 | |
Isobutyl isovalerate | C9H18O2 | 1.4060 | |
Isoamyl propionate | C8H16O2 | 1.4065 | |
d-sec.-Butyl valerate | C9H18O2 | 1.4070 | |
sec.-Amyl alcohol | CH3(C3H7)CH2OH | 1.4072 | |
Isoamyl alcohol | (CH3)2CHCH2CH2OH | 1.4075 | |
Amyl isobutyrate | (CH3)2CHCO2C5H11 | 1.4076 | |
Isobutyryl chloride | (CH3)2CHCOCl | 1.4079 | |
Triethyl phosphite | (C2H5O)3P | 1.4079 | |
4-Ethylheptane | (C3H7)2CHC2H5 | 1.408 | |
2,7-Dimethyloctane | C10H22 | 1.408 | |
Isoamyl ether | [(CH3)2CHCH2CH2]2O | 1.408 | |
Dipropyl ketone | (C3H7)2CO | 1.4082 | |
2-Methylnonane | (CH3)2CH(CH2)6CH3 | 1.408 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
n-Valeric acid | C5H11CO2H | 1.4086 | |
Isoamylamine | (CH3)2CHCH2CH2NH2 | 1.4088 | |
2,2-dichloropropane | 2,2-Dichloropropane | C3H6Cl2 | 1.4093 |
InChI=1/C3H6Cl2/c1-3(2,4)5/h1-2H3 | |||
CC(C)(Cl)Cl | |||
2,3-dimethylhexane | 2,3-Dimethylhexane | C8H18 | 1.4095 |
InChI=1/C8H18/c1-5-6-8(4)7(2)3/h7-8H,5-6H2,1-4H3 | |||
CC(C)C(C)CCC | |||
pentan-3-ol | Diethyl carbinol | C5H12O | 1.410 |
InChI=1/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 | |||
CCC(O)CC | |||
2-methyl-N-(2-methylpropyl)propan-1-amine | Diisobutylamine | C8H19N | 1.410 |
InChI=1/C8H19N/c1-7(2)5-9-6-8(3)4/h7-9H,5-6H2,1-4H3 | |||
CC(C)CNCC(C)C | |||
1-chloro-3-methylbutane | Isoamyl chloride | C5H11Cl | 1.4103 |
InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 | |||
CC(C)CCCl | |||
diethyl ethanedioate | Diethyl oxalate | C6H10O4 | 1.4104 |
InChI=1/C6H10O4/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3 | |||
CCOC(=O)C(=O)OCC | |||
hexan-2-ol | Methylbutyl carbinol | C6H14O | 1.411 |
InChI=1/C6H14O/c1-3-4-5-6(2)7/h6-7H,3-5H2,1-2H3 | |||
CC(O)CCCC | |||
Amyl n-butyrate | C4H9CO2C5H11 | 1.4110 | |
2,6-Dimethyloctane | C10H22 | 1.411 | |
3-Methyl-2(3)-hexene | C7H14 | 1.4114 | |
Methyl n-heptylate | C5H11CO2CH3 | 1.4114 | |
Capronitrile | C5H11CN | 1.4115 | |
5-Methylnonane | (C4H9)2CHCH3 | 1.4116 | |
1-Chloroethyl acetate | C4H7ClO2 | 1.4118 | |
n-Amyl chloride | CH3(CH2)4Cl | 1.4119 | |
3-Ethyl-2-pentene | (C2H5)2CCHCH3 | 1.412 | |
Butyryl chloride | C3H7COCl | 1.4121 | |
Ethyl n-heptylate | C6H13CO2C2H5 | 1.4122 | |
Diethyl dimethylmalonate | C9H16O4 | 1.4123 | |
3-Methylnonane | C2H5(CH3)CHC6H13 | 1.4126 | |
Isoamyl isovalerate | C10H20O2 | 1.4127 | |
Tetramethylethylene | C6H12 | 1.4128 | |
Isoamyl nitrate | C6H11NO3 | 1.4129 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Diethylacetic acid | (C2H5)2CHCO2H | 1.4130 | |
Heptaldehyde | C6H13CHO | 1.4131 | |
Diethyl methylmalonate | C8H14O4 | 1.4131 | |
Allyl alcohol | CH2CHCH2OH | 1.4134 | |
d-Methylbutyl carbinol | C6H14O | 1.4135 | |
Dimethyl malonate | H2C(CO2CH3)2 | 1.4136 | |
Caproicacid | C5H11CO2H | 1.4138 | |
Diethyl malonate | CH2(CO2C2H5)2 | 1.4138 | |
d-β-Octylformate | C9H18O2 | 1.414 | |
Tripropylmethane | (C3H7)3CH | 1.414 | |
l(d)-Ethylpropyl carbinol | C6H14O | 1.4141 | |
Allyl cyanide | CH2CHCH2CN | 1.4144 | |
n-Amyl valerate | C4H9CO2C5H11 | 1.4145 | |
d-Pinacolyl alcohol | C6H14O | 1.4146 | |
Propylisopropyl carbinol | C7H16O | 1.4149 | |
Glycol diacetate | (CH2OCOCH3)2 | 1.415 | |
Isocaproic acid | C6H12O2 | 1.4150 | |
4-Methyl-3-heptene | C8H16 | 1.415 | |
n-Decane | CH3(CH2)8CH3 | 1.415 | |
n-Heptyl acetate | CH3CO2C7H15 | 1.4153 | |
3-chloroprop-1-ene | 3-Chloropropylene | C3H5Cl | 1.4154 |
InChI=1/C3H5Cl/c1-2-3-4/h2H,1,3H2 | |||
C=CCCl | |||
n-Valeryl chloride | C4H9COCl | 1.4156 | |
Dimethylbutyl carbinol | C7H16O | 1.4159 | |
Methyl hexyl ketone | CH3COC6H13 | 1.4161 | |
N-Methylhydroxylamine | CH3NHOH | 1.4164 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
1,1-Dichloroethane | CH3CHCl2 | 1.4166 | |
2,4-dimethylpentan-2-ol | Dimethylisobutyl carbinol | C7H16O | 1.4172 |
InChI=1/C7H16O/c1-6(2)5-7(3,4)8/h6,8H,5H2,1-4H3 | |||
CC(C)CC(C)(C)O | |||
Isovaleric anhydride | C10H18O3 | 1.4174 | |
Tri-n-propylamine | (C3H7)3N | 1.4176 | |
2-Methyl-2-propylethyl alcohol | C6H14O | 1.4178 | |
Ethyl cyanoacetate | NCCH2CO2C2H5 | 1.4179 | |
2,2,3-Trimethylpentane | C8H18 | 1.4184 | |
n-Undecane | CH3(CH2)9CH3 | 1.4184 | |
Ethyl 1-chloropropionate | C6H9ClO2 | 1.4185 | |
Ethyl 2-chloropropionate | C6H9ClO2 | 1.4185 | |
Allylamine | CH2CHCH2NH2 | 1.4186 | |
n-Hexyl chloride | C5H11CH2Cl | 1.4194 | |
Ethyl methylacetoacetate | C7H12O3 | 1.419 | |
Heptylnitrile | C6H13CN | 1.4195 | |
Methyl acetoacetate | C6H8O3 | 1.4196 | |
Methyldiethyl carbinol | C6H14O | 1.4196 | |
Ethyl acetoacetate | C6H10O3 | 1.4198 | |
Paraldehyde | (CH3CHO)3 | 1.4198 | |
3-methylpentan-2-ol | Methyl-sec.-butyl carbinol | C6H14O | 1.420 |
InChI=1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3 | |||
CC(CC)C(C)O | |||
Diethyl succinate | (CH2CO2C2H5)2 | 1.420 | |
6-methylheptan-3-ol | Ethylisoamyl carbinol | C8H18O | 1.4201 |
InChI=1/C8H18O/c1-4-8(9)6-5-7(2)3/h7-9H,4-6H2,1-3H3 | |||
CC(C)CCC(O)CC | |||
2-methylheptan-4-ol | Propylisobutyl carbinol | C8H18O | 1.4203 |
InChI=1/C8H18O/c1-4-5-8(9)6-7(2)3/h7-9H,4-6H2,1-3H3 | |||
CC(C)CC(O)CCC | |||
2-methylheptan-3-ol | Isopropylbutyl carbinol | C8H18O | 1.4204 |
InChI=1/C8H18O/c1-4-5-6-8(9)7(2)3/h7-9H,4-6H2,1-3H3 | |||
CC(C)C(O)CCCC | |||
n-Octyl acetate | CH3CO2C8H17 | 1.4204 | |
d-Ethylbutyl carbinol | C7H16O | 1.4206 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Propargyl acetate | CHCCH2O2CCH3 | 1.4207 | |
d-Methylamyl carbinol | C7H16O | 1.4209 | |
Dimethylisoamyl carbinol | C8H18O | 1.4209 | |
n-Dodecane | CH3(CH2)10CH3 | 1.4209 | |
Dipropyl carbinol | (C3H7)2CHOH | 1.421 | |
p-Dimethylcyclohexane | C8H16 | 1.421 | |
d-γ-Nonyl formate | C10H20O2 | 1.421 | |
Methyl-n-amyl carbinol | C7H16O | 1.4213 | |
Furfural (Furan) | C4H4O | 1.4216 | |
Caprylic aldehyde | C7H16CHO | 1.4217 | |
Ethylurethane | C2H5NHCO2C2H5 | 1.4219 | |
Ethyl levulinate | C7H12O3 | 1.4223 | |
Acrylic acid | H2CCHCO2H | 1.4224 | |
Diisopropyl carbinol | C7H16O | 1.4226 | |
l-Hydroxy-2-methylhexane | C7H16O | 1.4226 | |
Ethyl chloroacetate | ClCH2CO2C2H5 | 1.4227 | |
5-Propylnonane | (C4H9)2CHC3H7 | 1.4228 | |
Heptylic acid | C6H13CO2H | 1.423 | |
Methylethylpropyl carbinol | C7H16O | 1.423 | |
Diisobutyl carbinol | C9H20O | 1.423 | |
Methylcyclohexane | C7H14 | 1.4235 | |
Methylene chloride | CH2Cl2 | 1.4237 | |
Methylisohexyl carbinol | C8H18O | 1.4238 | |
Ethyl bromide | C2H6Br | 1.4239 | |
Crotonyl alcohol | CH3CHCHCH2OH | 1.4240 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Vinylethyl carbinol | C6H10O | 1.4240 | |
n-Heptylamine | C7H15NH2 | 1.424 | |
d-sec.-Octyl alcohol | C6H13CH(OH)CH3 | 1.424 | |
Pelargonic aldehyde | CH3(CH2)7CHO | 1.424 | |
Diisoamylamine | C10H23N | 1.424 | |
Diethyl diethylmalonate | C11H20O4 | 1.424 | |
ethyl α-crotonate | C6H10O2 | 1.4242 | |
n-Butyl ethyl malonate | C9H16O4 | 1.4242 | |
2-Chloroethyl acetate | C4H7ClO2 | 1.4247 | |
Isobutyl ethyl malonate | C9H16O4 | 1.4248 | |
n-Heptyl alcohol | C7H15OH | 1.425 | |
m-Dimethylcyclohexane | C8H16 | 1.425 | |
Isopropyl bromide | (CH3)2CHBr | 1.4251 | |
Succinic dialdehyde | (CH2CHO)2 | 1.4254 | |
Isoheptyl alcohol | C7H16O | 1.4254 | |
sec.-Octylamine | C6H13CH(CH3)NH | 1.4254 | |
Propyl isopropyl malonate | C9H16O4 | 1.4259 | |
Triisobutylamine | [(CH3)2CHCH2]3N | 1.426 | |
Levulinic aldehyde | C6H8O2 | 1.4263 | |
Caprylic acid | CH3(CH2)6COOH | 1.4268 | |
4-methylheptan-4-ol | Methyl dipropyl carbinol | C8H18O | 1.427 |
InChI=1/C8H18O/c1-4-6-8(3,9)7-5-2/h9H,4-7H2,1-3H3 | |||
CC(O)(CCC)CCC | |||
Methylethylbutylcarbinol | C8H18O | 1.4270 | |
Dipropylhexylmethane | (C3H7)2CHC6H13 | 1.427 | |
Tributylmethane | (C4H9)3CH | 1.427 | |
Ethyl hydrogen malonate. | C6H8O4 | 1.4271 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
2-Methyl-5-ethyl-5-heptene | C10H20 | 1.4271 | |
Methylacetyl carbinol (Acetoin) | C4H8O2 | 1.4272 | |
cyclohexane | Cyclohexane | C6H12 | 1.4273 |
InChI=1/C6H12/c1-2-4-6-5-3-1/h1-6H2 | |||
C1CCCCC1 | |||
Glycol | HOCH2CH2OH | 1.4274 | |
Isoamyl ethyl malonate | C10H18O4 | 1.4275 | |
n-Capric aldehyde | CH3(CH2)8CHO | 1.4275 | |
Methylethylisobutyl carbinol | C8H18O | 1.4278 | |
tert.-Butyl bromide | (CH3)3CBr | 1.428 | |
sec.-Butyl ethyl malonate | C9H16O4 | 1.4284 | |
Isobutylurethane | C4H9NHCO2C2H | 1.4288 | |
Methyl n-nonyl ketone | C11H22O | 1.4289 | |
Ethyl hydracrylate | C6H10O3 | 1.429 | |
Isoamyl isopropyl malonate | C11H20O4 | 1.4293 | |
Acetyl carbinol | CH3COCH2OH | 1.4295 | |
Diethyl ethylacetylmalonate | C11H18O6 | 1.4299 | |
o-Dimethylcyclohexane | C8H16 | 1.430 | |
n-Octyl alcohol | CH3(CH2)7OH | 1.430 | |
n-Octylamine | C8H17NH2 | 1.430 | |
Dibutyl carbinol | (C4H9)2CHOH | 1.430 | |
Dimethyl propenyl carbinol | C6H12O | 1.4302 | |
Dimethyl-n-amyl carbinol | C8H18O | 1.4303 | |
Ethylmercaptan | C2H5SH | 1.4306 | |
Propargyl alcohol | HCCCH2OH | 1.4306 | |
Ethyl propargyl ether | CHCCH2OC2H6 | 1.4306 | |
Glycerol triacetate | C9H14O6 | 1.4306 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Ethyl diethylacetoacetate | C10H18O3 | 1.4309 | |
Methylethylisoamyl carbinol | C9H20O | 1.4310 | |
Methylpropylisobutyl carbinol | C9H20O | 1.431 | |
n-Butyl isopropylmalonate | C10H18O4 | 1.4311 | |
n-Heptylic anhydride | (C6H13CO)2O | 1.4312 | |
l-Methylacrylic acid | C4H6O2 | 1.4314 | |
Triethyl carbinol | (C2H5)3COH | 1.4314 | |
Butyl-sec.-butyl carbinol | C9H20O | 1.4317 | |
Methyl hydracrylate | C4H8O3 | 1.432 | |
Ethyl laurate | C11H23CO2C2H5 | 1.4321 | |
Di-sec.-butyl carbinol | C9H20O | 1.4322 | |
Diethylpropyl carbinol | C8H18O | 1.433 | |
Pelargonic acid | CH3(CH2)7COOH | 1.4330 | |
β-undecylene | CH3CHCH(CH2)7CH3 | 1.4333 | |
Undecylic aldehyde | C11H22O | 1.4334 | |
Cyclobutanol | (CH2)3CHOH | 1.4335 | |
n-Nonyl alcohol | CH3(CH2)8OH | 1.4338 | |
Amyl chloroacetate | ClCH2COOC6H11 | 1.434 | |
n-Propyl bromide | CH3CH2CH2Br | 1.4341 | |
sec.-Butyl bromide | C2H5CHBrCH3 | 1.4344 | |
Methylethyl-tert.-amyl carbinol | C9H20O | 1.4345 | |
Dichloroethyl alcohol | Cl2CHCH2OH | 1.4346 | |
1,1,1-Trichloroethane | CH3CCl3 | 1.4349 | |
Tributyrin | C15H26O6 | 1.4359 | |
Isobutyl bromide | (CH3)2CHCH2Br | 1.436 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Cyclopentanone | C6H8O | 1.436 | |
2-Chloropropyl alcohol | C3H7ClO | 1.4362 | |
Diethyl malate | C8H14O5 | 1.4362 | |
Dimethylnitrosamine | (CH3)2NNO | 1.4364 | |
dl-sec.-Octyl alcohol | C6H13CH(OH)CH3 | 1.437 | |
p-Menthane | C10H20 | 1.437 | |
n-Heptadecane | CH3(CH2)15CH3 | 1.437 | |
Amyl l-α-crotonate | C9H16O2 | 1.4371 | |
Crotonaldehyde | CH3CHCHCHO | 1.4373 | |
p-Difluorobenzene | C6H4F2 | 1.4375 | |
Thujane | C10H18 | 1.4376 | |
Tetranitromethane | C(NO2)4 | 1.438 | |
N-Dimethylacetamide | CH3CON(CH3)2 | 1.438 | |
Dipropyl malate | C10H18O5 | 1.4380 | |
Ethyl dichloroacetate | C4H6Cl2O2 | 1.4386 | |
Isobutyl mercaptan | (CH3)2CHCH2SH | 1.4386 | |
Diethyl itaconate | C9H14O4 | 1.4388 | |
Ethylideneacetone | CH3CHCHCOCH3 | 1.4390 | |
Chloroisopropyl alcohol | C3H7ClO | 1.4392 | |
n-Butyl bromide | C4H9Br | 1.4398 | |
Glycerol triformate (Triformin) | C6H8O6 | 1.4404 | |
n-Undecyl alcohol | CH3(CH2)9CH2OH | 1.4404 | |
Diethyl maleate | OCHCO2C2H3)2 | 1.4407 | |
Pentane-1,2-diol | C3H7CHOHCH2OH | 1.441 | |
Diethyl fumarate | (CHCO2C2H5)2 | 1.4410 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Isoamyl bromide | (CH3)2CHCH2CH2Br | 1.4412 | |
Isoamyl mercaptan | C5H12S | 1.4412 | |
Dipropargyl | C6H6 | 1.4413 | |
dl-Lactic acid | CH3CH(OH)CO2H | 1.4414 | |
Dimethyl maleate | C6H8O4 | 1.4415 | |
Levulinic acid | CH3COCH2CH2COOH | 1.4416 | |
m-Difluorobenzene | C6H4F2 | 1.4417 | |
4-Methylcyclohexene | C7H12 | 1.4419 | |
dl-2-Chlorobutyric acid | C4H7ClO2 | 1.442 | |
m-Menthane | C10H20 | 1.4420 | |
α-Hexadecylene | CH2:CH(CH2)13CH3 | 1.442 | |
tert-Amyl bromide | (CH3)2(C3H5)CBr | 1.4421 | |
Ethyl sulfide | (C2H5)2S | 1.4425 | |
Dimethyl malate | C6H10O5 | 1.4425 | |
Tricaproin | C21H38O6 | 1.4427 | |
Methyl ethyl ketoxime | C4H9NO | 1.4428 | |
4-methylcyclohexene | C7H12 | 1.443 | |
1-Bromoethyl acetate | C4H7BrO2 | 1.4433 | |
n-Amyl mercaptan | C5H12S | 1.4437 | |
d-Laurolene | C8H14 | 1.4438 | |
1,2,3,4-Tetrahydro-m-xylene | C8H14 | 1.444 | |
Campholene | C9H16 | 1.4441 | |
1,2-dichloroethane | Ethylene chloride | C2H4Cl2 | 1.4443 |
InChI=1/C2H4Cl2/c3-1-2-4/h1-2H2 | |||
ClCCCl | |||
1-bromopentane | n-Amyl bromide | C5H11Br | 1.4444 |
InChI=1/C5H11Br/c1-2-3-4-5-6/h2-5H2,1H3 | |||
BrCCCCC | |||
d-Citronellyl acetate | C12H22O2 | 1.4445 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Methylpropylketoxime | C6H11NO | 1.4450 | |
1,2,3,4-Tetrahydrobenzene | C6H10 | 1.4451 | |
cycloheptane | Heptamethylene (Cycloheptane) | C7H14 | 1.4452 |
InChI=1/C7H14/c1-2-4-6-7-5-3-1/h1-7H2 | |||
C1CCCCCC1 | |||
Homomesityl oxide | C8H14O | 1.4453 | |
Diethylketoxime | (C2H5)2CNOH | 1.4454 | |
3-methylcyclohexene | C7H12 | 1.4454 | |
Triethyl citrate | C12H20O7 | 1.4455 | |
d-Citronellol | C10H20O | 1.4456 | |
β-Crotonic acid | CH2C(CH3)COOH | 1.4457 | |
tetradecane | n-Tetradecane | C14H30 | 1.4459 |
InChI=1/C14H30/c1-3-5-7-9-11-13-14-12-10-8-6-4-2/h3-14H2,1-2H3 | |||
CCCCCCCCCCCCCC | |||
triethylphosphane | Triethylphosphine | C6H15P | 1.446 |
InChI=1/C6H15P/c1-4-7(5-2)6-3/h4-6H2,1-3H3 | |||
CCP(CC)CC | |||
l-Linalyl acetate | C12H20O2 | 1.4460 | |
bromoethene | Vinyl bromide | C2H3Br | 1.4462 |
InChI=1/C2H3Br/c1-2-3/h2H,1H2 | |||
BrC=C | |||
l-Methylpiperidine | C6H13N | 1.4464 | |
trichloromethane | Chloroform | CHCl3 | 1.4467 |
InChI=1/CHCl3/c2-1(3)4/h1H | |||
ClC(Cl)Cl | |||
l-Menthyl acetate | (HOCHCO2C4H9)2 | 1.4468 | |
Ethyl 1-bromopropionate | C6H9BrO2 | 1.4469 | |
β-Thujene | C10H16 | 1.4471 | |
Diethyl d-tartrate | [CH(OH)CO2C2H5]2 | 1.4476 | |
n-Hexyl bromide | C5H11CH2Br | 1.4478 | |
d-Menthene | C10H18 | 1.4481 | |
Ethyl 1,2-dichloropropionate | C6H8Cl2O2 | 1.4482 | |
Tricaprylin | C27H50O6 | 1.4482 | |
2,2-Dimethylcyclohexanone | C8H14O | 1.4486 | |
l-Menthyl isovalerate | C15H28O2 | 1.4486 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Acetonylacetone | (CH3COCH2)2 | 1.449 | |
Isohexyl alcohol | C6H14O | 1.4490 | |
Tiglic aldehyde | CH3CHC(CH3)CHO | 1.4495 | |
1-methylcyclohexene | C7H12 | 1.4496 | |
Pentane-1,5-diol | CH2(CH2CH2OH)2 | 1.4499 | |
Ethylenediamine hydrate | C2H10N2O | 1.4500 | |
2-Methyl-2-heptene-6-ol | C8H16O | 1.4503 | |
Fenchylene | C10H16 | 1.4505 | |
Methyl 1-bromopropionate | C4H7BrO2 | 1.4506 | |
Ethyl trichloroacetate | Cl3CCO2C2H5 | 1.4507 | |
Ethyl bromoaecetate | BrCH2CO2C2H5 | 1.451 | |
Acetylacetone | CH3COCH2COCH3 | 1.4512 | |
α-Thujene | C10H16 | 1.4515 | |
dl-Menthone | C10H18O | 1.4521 | |
1,2-Isoheptenic acid | C7H12O2 | 1.4524 | |
Diisoamyl sulfide | C10H22S | 1.4524 | |
Piperidine | C5H11N | 1.4530 | |
1,3,3-trimethyltricyclo[2.2.1.02,6]heptane | Cyclofenchene | C10H16 | 1.4532 |
InChI=1/C10H16/c1-9(2)6-4-7-8(9)10(7,3)5-6/h6-8H,4-5H2,1-3H3 | |||
CC3(C)C1CC2(C)C(C1)C23 | |||
2-Aminoethyl alcohol | H2NCH2CH2OH | 1.4539 | |
cis-3,5-Dimethylcyclohexanol | C8H16O | 1.4540 | |
d-Pinane | C10H18 | 1.4540 | |
Ethyl erucate | C21H41COOC2H5 | 1.4543 | |
2-Bromoethyl acetate | C4H7BrO2 | 1.4550 | |
Cyclohexyl chloride | C6H11Cl | 1.455 | |
1-Bromopropylene | CH3CHCHBr | 1.4554 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Citronellyl formate | C11H17O2 | 1.4556 | |
Triethyl aconitate | C12H18O6 | 1.4556 | |
Chloral | Cl3CCHO | 1.4557 | |
Oleic aldehyde | C18H34O | 1.4557 | |
Methyl erucate | C21H41CO2CH3 | 1.4558 | |
Bromomethyl methyl ether | C2H6BrO | 1.4562 | |
3,7,7-trimethylbicyclo[4.1.0]heptane | Carane | C10H18 | 1.4567 |
InChI=1/C10H18/c1-7-4-5-8-9(6-7)10(8,2)3/h7-9H,4-6H2,1-3H3 | |||
CC2(C)C1CCC(C)CC12 | |||
Methyl 2-bromopropionate | C4H7BrO2 | 1.4570 | |
2-Chloroethyl ether | (C1CH2CH2)20 | 1.457 | |
(1R,3S)-1-methyl-3-(propan-2-yl)cyclopentanecarboxylic acid | Fencholic acid | C10H18O2 | 1.457 |
InChI=1/C10H18O2/c1-7(2)8-4-5-10(3,6-8)9(11)12/h7-8H,4-6H2,1-3H3,(H,11,12)/t8-,10+/m0/s1 | |||
OC(=O)[C@]1(C)CC[C@@H](C1)C(C)C | |||
trans-3,5-Dimethylcyclohexanol | C8H16O | 1.4574 | |
l-Citronellol | C10H20O | 1.4579 | |
Methyl ricinolate | C19H36O3 | 1.4580 | |
m-Hexahydrocresol | C7H14O | 1.4581 | |
dl-m-Hexahydrocresol | C7H14O | 1.4590 | |
3,3-Dimethylcyclohexanol | C8H16O | 1.459 | |
n-Heptyl iodide | C7H15I | 1.4594 | |
Chloropicrin | Cl3CNO2 | 1.4595 | |
Adipyldinitrile | C6H8N2 | 1.4597 | |
Oleic acid ozonide | C18H34O5 | 1.4602 | |
l-Neomenthol | C10H20O | 1.4603 | |
Cineol | C10H18O | 1.4606 | |
l-Menthylamine | C10H21N | 1.4606 | |
tetrachloromethane | Carbon tetrachloride | CCl4 | 1.4607 |
InChI=1/CCl4/c2-1(3,4)5 | |||
ClC(Cl)(Cl)Cl | |||
Pinocamphane | C10H18 | 1.4609 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
o-Hexahydrocresol | C7H14O | 1.461 | |
Nopinane | C9H16 | 1.4614 | |
d-Linalool | C10H18O | 1.4623 | |
Ethyl ricinoleate | C20H38O3 | 1.4626 | |
Pentamethylenediamine | C5H14N2 | 1.463 | |
dl-Bornyl acetate | C12H20O2 | 1.4630 | |
Phytol | C20H40O | 1.4636 | |
sec.-Menthyl chloride | C10H19Cl | 1.4642 | |
Santene | C9H14 | 1.4643 | |
fluorobenzene | Fluorobenzene | C6H5F | 1.4646 |
InChI=1/C6H5F/c7-6-4-2-1-3-5-6/h1-5H | |||
Fc1ccccc1 | |||
tert.-Menthyl chloride | C10H19Cl | 1.4649 | |
3-bromoprop-1-ene | 3-Bromopropylene | C3H5Br | 1.4655 |
InChI=1/C3H5Br/c1-2-3-4/h2H,1,3H2 | |||
BrCC=C | |||
dichloroacetic acid | Dichloroacetic acid | C2H2Cl2O2 | 1.4659 |
InChI=1/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) | |||
ClC(Cl)C(=O)O | |||
Geranyl formate | C11H18O2 | 1.4659 | |
Ethyl diacetoacetate | C8H12O4 | 1.4660 | |
Geranyl acetate | C12H20O2 | 1.4660 | |
ethyl thiocyanate | Ethyl thiocyanate | C3H5NS | 1.4666 |
InChI=1/C3H5NS/c1-2-5-3-4/h2H2,1H3 | |||
N#CSCC | |||
Triethyl arsine | (C2H5)3As | 1.467 | |
2,2-Dimethylcyclohexanol | C8H16O | 1.467 | |
Δ1,5-5-Dihydro-m-xylene | C8H12 | 1.4675 | |
2,4-Dihydrotoluene | C7H10 | 1.4680 | |
Isopulegon | C10H16O | 1.4690 | |
1-fluoro-3-methylbenzene | m-Fluorotoluene | C7H7F | 1.4691 |
InChI=1/C7H7F/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 | |||
Cc1cc(F)ccc1 | |||
Methyl thiocyanate | CH3CNS | 1.4697 | |
p-Fluorotoluene | C7H7F | 1.470 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Myrcene | C10H16 | 1.4700 | |
trans-Decahydronaphthalene | C10H18 | 1.4701 | |
o-Fluorotoluene | C7H7F | 1.4704 | |
1,1,2-trichloroethane | 1,1,2-Trichloroethane | C2H3Cl3 | 1.4711 |
InChI=1/C2H3Cl3/c3-1-2(4)5/h2H,1H2 | |||
ClCC(Cl)Cl | |||
Pinol | C10H16O | 1.4715 | |
Citraconic anhydride | C6H4O3 | 1.4717 | |
l-Isopulegol | C10H18O | 1.4723 | |
d(l)-Limonene | C10H16 | 1.4727 | |
Geranylamine | C10H19N | 1.4727 | |
Glycerol | HOCH(CH2OH)2 | 1.4729 | |
Isopulegol | C10H18O | 1.4729 | |
pentylbenzene | n-Amylbenzene | C11H16 | 1.473 |
InChI=1/C11H16/c1-2-3-5-8-11-9-6-4-7-10-11/h4,6-7,9-10H,2-3,5,8H2,1H3 | |||
CCCCCc1ccccc1 | |||
Dipentene | C10H16 | 1.473 | |
Geranylacetic acid | C12H20O2 | 1.4739 | |
Geranyl chloride | C10H17Cl | 1.4741 | |
Ascaridol | C10H16O2 | 1.4743 | |
1,3-Cyclohexadiene | C6H8 | 1.4744 | |
Crotonic anhydride | C8H10O3 | 1.4745 | |
β-Terpineol | C10H18O | 1.4747 | |
dl-1-Bromopropionic acid | C3H5BrO2 | 1.4753 | |
1,1,2-Trichlorobutyraldehyde | C4H5Cl3O | 1.4755 | |
1,3-Dihydrotoluene | C7H10 | 1.4763 | |
Trichloroethylene | Cl2CCHCl | 1.4777 | |
d-Terpinen-4-ol (Origanol) | C10H18O | 1.4785 | |
β-Phellandrene | C10H16 | 1.4788 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
1,1,1,2-Tetrachloroethane | C2H2Cl4 | 1.479 | |
Δ1,3-3-Dihydro-p-xylene | C8H12 | 1.4792 | |
Homophorone | C12H20O | 1.4792 | |
Geraniol | C10H18O | 1.4798 | |
1,1'-Dichloroisopropyl alcohol | C3H6Cl2O | 1.4801 | |
dl-Terpinen-4-ol | C10H18O | 1.4803 | |
2-Hydroxyglutaric nitrile | C6H6N2O | 1.4805 | |
Cetyl iodide | C15H31CH2I | 1.4806 | |
Benzyl myristate | C13H27CO2CH2C6H5 | 1.482 | |
Terpinolene | C10H16 | 1.4.823 | |
dl, α-Terpineol | C10H18O | 1.4827 | |
cis-Decahydronaphthalene | C10H18 | 1.4828 | |
Benzyl laurate | C11H23CO2CH2C6H5 | 1.483 | |
Δ1,5-Terpinene | C10H16 | 1.4846 | |
d(l)-Piperitone | C10H14O | 1.4848 | |
n-Caproyl chloride | C5H11COCl | 1.4867 | |
Geranic acid | C10H16O2 | 1.4870 | |
Phenyl isoamyl ether | C11H16O | 1.4872 | |
Sabinol | C10H16O | 1.488 | |
l-Eegonine methyl ester | C10H17NO3 | 1.488 | |
Farnesol | C15H26O | 1.4881 | |
n-Octyl iodide | CH3(CH2)6CH2I | 1.489 | |
sec.-Butylbenzene | C2H5(CH3)CHC6H5 | 1.4890 | |
Umbellulone | C10H14O | 1.4895 | |
Δ1-Tetrahydrobenzoic acid | C7H10O2 | 1.4903 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Phellandral | C10H16O | 1.4911 | |
n-Butylbenzene | CH3(CH2)3C6H5 | 1.4914 | |
2-Bromoethyl alcohol | BrCH2CH2OH | 1.4915 | |
n-Propylbenzene | CH3(CH2)2C6H5 | 1.4920 | |
Benzyl isobutyrate | C11H14O2 | 1.4922 | |
Benzyl d-valerate | C12H16O2 | 1.4922 | |
Cymene | m-CH3(CH2)2C6H4CH3 | 1.4925 | |
1-iodohexane | n-Hexyl iodide | C6H13I | 1.4929 |
InChI=1/C6H13I/c1-2-3-4-5-6-7/h2-6H2,1H3 | |||
CCCCCCI | |||
Cumene | (CH3)2CHC6H5 | 1.4930 | |
(2-methylpropyl)benzene | Isobutylbenzene | C10H14 | 1.493 |
InChI=1/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 | |||
CC(C)Cc1ccccc1 | |||
d-β-Butyl benzoate | C11H14O2 | 1.4930 | |
Camphenamine | C10H17N | 1.4935 | |
1,3,5-Triethylbenzene | C12H18 | 1.4939 | |
Amyl benzoate | C6H6CO2C5H11 | 1.494 | |
1,1,2,2-Tetrachloroethane | C2H2Cl4 | 1.4942 | |
p-Ethyltoluene | p-C2H5C6H4CH3 | 1.4943 | |
p-Diethylbenzene | p-(C2H5)2C6H4 | 1.495 | |
Spinacene | C29H48 | 1.4951 | |
Ethyl hydrocinnamate | C11H14O2 | 1.4954 | |
n-Amyl iodide | CH3(CH2)4I | 1.4955 | |
p-Xylene | p-C6H4(CH3)2 | 1.4956 | |
Zingiberene | C15H24 | 1.4956 | |
Cyclohexyl bromide | C6H11Br | 1.4959 | |
Ethylbenzene | C6H5CH2CH3 | 1.4959 | |
Isobutyl iodide | (CH3)2CHCH2I | 1.4960 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Toluene | C7H8 | 1.4962 | |
Mesitylene | 1,3,5-(CH3)3C6H3 | 1.4967 | |
Myrtenol | C10H16O | 1.4967 | |
Butylbenzene | (CH3)3CC6H5 | 1.4969 | |
1,2,4-Triethylbenzene | C12H18 | 1.4972 | |
m-Xylene | m-C6H4(CH3)2 | 1.4973 | |
m-Ethyltoluene | m-C2H5C6H4CH3 | 1.4975 | |
Myrtenyl chloride | C10H15Cl | 1.4976 | |
Ethyl dibromoacetate | Br2CHCO2C2H5 | 1.498 | |
Ethyl phenylacetate | C6H6CH2CO2C2H6 | 1.498 | |
Cedrene | C15H24 | 1.4981 | |
1,5,11,11-tetramethyltricyclo[6.2.1.02,6]undec-2(6)-ene | Patchoulene | C15H24 | 1.4984 |
InChI=1/C15H24/c1-10-5-6-13-12(10)9-11-7-8-15(13,4)14(11,2)3/h10-11H,5-9H2,1-4H3/t10-,11+,15-/m1/s1 | |||
C31=C(C2(CCC(C1)C2(C)C)C)CCC3C | |||
Verbenene | C10H14 | 1.4986 | |
Diethyl mesaconate | C9H14O4 | 1.4993 | |
d-Methylbenzylcarbinyl formate | C10H12O2 | 1.4995 | |
α-Caryophyllene | C15H24 | 1.4996 | |
Isopropyl iodide | (CH3)2CHI | 1.4997 | |
Phorone | C9H14O | 1.4998 | |
p-Cresyl acetate | p-CH3CO2C6H4CH3 | 1.500 | |
n-Butyl iodide | C4H9I | 1.5001 | |
o-Cymene | o-CH3(CH2)2C6H4CH3 | 1.5003 | |
Guajene | C15H24 | 1.5005 | |
Clovene | C15H24 | 1.5007 | |
α-Picoline | C6H7N | 1.501 | |
Irone | C13H20O | 1.5011 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Benzene | C6H6 | 1.5014 | |
Diethyl o-phthalate | o-C6H4(CO2C2H5)2 | 1.5019 | |
Ethyl sorbate | CH3(CHCH)2COOC2H5 | 1.5023 | |
1,2,4,5-Tetraethylbenzene | C14H22 | 1.5025 | |
Phenyl acetate | CH3COOC6H5 | 1.503 | |
β-Elemol | C15H26O | 1.5030 | |
Pyrrole | C4H5N | 1.5035 | |
Pinylamine | C10H17N | 1.5036 | |
1,1,1,2,2-pentachloroethane | Pentachloroethane | C2HCl5 | 1.504 |
InChI=1/C2HCl5/c3-1(4)2(5,6)7/h1H | |||
ClC(Cl)C(Cl)(Cl)Cl | |||
o-Ethyltoluene | o-C2H5C6H4CH3 | 1.5042 | |
Myrtenal (Myrtenic aldehyde) | C10H14O | 1.5042 | |
γ-Santalene | C15H24 | 1.5042 | |
Ethyl iodoacetate | ICH2COOC2H5 | 1.5046 | |
o-Cresyl methyl ether | o-CH3C6H4OCH3 | 1.505 | |
Pinocarvol | C10H14O | 1.5050 | |
n-Propyl iodide | CH3CH2CH2I | 1.5051 | |
Pseudocumene | 1,2,4-(CH3)3C6H3 | 1.5051 | |
Tetrachloroethylene | Cl2CCCl2 | 1.5055 | |
Ethyl m-toluate | CH3C6H4CO2C2H6 | 1.5057 | |
Atractylene | C15H24 | 1.5057 | |
o-Xylene | o-C6H4(CH3)2 | 1.5058 | |
m-Cresyl methyl ether | C8H10O | 1.506 | |
Ethyl benzoate | C6H5COOC2H5 | 1.506 | |
Ethyl o-toluate | CH3C6H4CO2C2H6 | 1.506 | |
Ethyl disulfide | (C2H5S)2 | 1.5063 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
l-Cadinene | C15H24 | 1.5065 | |
1,3-Dibromobutane | C4H8Br2 | 1.507 | |
Phenetol | C6H5OC2H5 | 1.507 | |
Isobutyl anisate | C12H16O3 | 1.507 | |
Butyl anisate | p-CH3OC6H4CO2C4H9 | 1.1508 | |
Ethyl p-toluate | CH3C6H4CO2C2H6 | 1.5081 | |
1,2,3,4-Tetraethylbenzene | C14H22 | 1.5083 | |
Isoamyl anisate | C13H18O3 | 1.5085 | |
1,2-Dibromo-2-methylpropane | C4H8Br2 | 1.509 | |
m-Toluicacid | m-CH3C6H4COOH | 1.509 | |
Pyridine | C6H6N | 1.509 | |
Nicotoine | C8H11N | 1.5105 | |
Ethyl iodide | C2H5I | 1.512 | |
Pentachloropropane | C3H3Cl5 | 1.512 | |
p-Cresyl methyl ether | C8H10O | 1.512 | |
1,1-Dibromoethane | CH3CHBr2 | 1.5128 | |
Ethyl m-cresyl ether | C9H12O | 1.513 | |
2-Dimethylamino-m-xylene | C10H15N | 1.5131 | |
Hemimellitene | 1,2,3-(CH3)3C6H3 | 1.5132 | |
Ethyl isothiocyanate | C2H5CSN | 1.5134 | |
m-Fluorophenol | C6H5FO | 1.514 | |
Propyl anisate | p-CH3OC6H4CO2C3H7 | 1.514 | |
Benzylethylene | C6H5CH2CHCH2 | 1.5143 | |
Pentaethylbenzene | C16H26 | 1.516 | |
Methyl benzoate | C6H5COOCH3 | 1.5164 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Eudesmol | C15H26O | 1.5164 | |
Methyl l-phenylethyl carbinol | C10H14O | 1.5168 | |
Phenyl methyl ether (Anisol) | C7H8O | 1.517 | |
d-Benzylmethyl carbinol | C9H12O | 1.5174 | |
2,4,6-Trimethylacetophenone | C11H14O | 1.5175 | |
1,2,3,4-Tetramethylbenzene | C10H14 | 1.5187 | |
4-Dimethylamino-o-xylene | C10H15N | 1.5201 | |
1,2-Dibromopropane | CH3CHBrCH2Br | 1.5203 | |
Eugenol acetate | C12H14O3 | 1.5207 | |
p-Chlorotoluene | C7H7Cl | 1.521 | |
β-Ionone | C13H20O | 1.521 | |
d-Methylphenyl carbinol | C8H10O | 1.5211 | |
3-Methyl-2-hydroxyisopropylbenzene | C10H14O | 1.5218 | |
Ethyl salicylate | HOC6H4COOC2H5 | 1.5226 | |
1,3-Dibromopropane | C3H6Br2 | 1.523 | |
m-Chlorotoluene | C7H7Cl | 1.523 | |
Benzyl acetate | CH3CO2CH2C8H5 | 1.5232 | |
5-Methyl-2-hydroxyisopropylbenzene | C10H14O | 1.5234 | |
Benzyl chloroacetate | C9H9ClO2 | 1.523 | |
Methyl chavicyl ether | C10H12O | 1.5236 | |
2-Phenylethyl alcohol | C6H5CH2CH2OH | 1.5240 | |
Carvacrol | C10H14O | 1.524 | |
Benzyl cyanide | C6H6CH2CN | 1.5242 | |
Ethyl anisate | p-CH3OC6H4CO2C2H5 | 1.5249 | |
chlorobenzene | Chlorobenzene | C6H5Cl | 1.525 |
InChI=1/C6H5Cl/c7-6-4-2-1-3-5-6/h1-5H | |||
Clc1ccccc1 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Dimethyl-o-toluidine | C9H13N | 1.525 | |
p-Methylbutyrophenone | C11H14O | 1.5250 | |
Benzyl dichloroacetate | C9H8Cl2O2 | 1.526 | |
furan-2-carbaldehyde | Furfural | C5H4O2 | 1.5261 |
InChI=1/C5H4O2/c6-4-5-2-1-3-7-5/h1-4H | |||
O=Cc1ccco1 | |||
Tropylidene | C7H8 | 1.5261 | |
Allyl isothiocyanate | CH2CHCH2CSN | 1.5266 | |
m-Fluoronitrobenzene | C6H4FNO2 | 1.5267 | |
Ethyl phenyl ketone | C2H5COC6H5 | 1.527 | |
p-Tolyl ethyl ketone | C10H12O | 1.5271 | |
1-chloro-2-methylbenzene | o-Chlorotoluene | C7H7Cl | 1.528 |
InChI=1/C7H7Cl/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 | |||
Cc1ccccc1Cl | |||
Benzyl trichloroacetate | C9H7Cl3O2 | 1.5282 | |
thiophene | Thiophene | C4H4S | 1.5285 |
InChI=1/C4H4S/c1-2-4-5-3-1/h1-4H | |||
c1cccs1 | |||
Elemicin | C12H16O3 | 1.5285 | |
Nicotine | C10H14N2 | 1.5286 | |
Methyl iodide | CH3I | 1.5297 | |
Bromotrichloromethane | CBrCl3 | 1.5300 | |
Cumic aldehyde | (CH3)2CHC6H4CHO | 1.5301 | |
ω-Mesitylamine | C9H13N | 1.5305 | |
o-Fluoronitrobenzene | C6H4FNO2 | 1.5311 | |
Di-(2-chloroethyl) sulfide | (CH3CHCl)2S | 1.5313 | |
Phenylnitromethane | C7H7NO2 | 1.5323 | |
p-Methylacetophenone (Melilot) | C9H10O | 1.5335 | |
Ethyl benzoylacetate | C11H12O3 | 1.5338 | |
1-phenylethanone | Acetophenone | C8H8O | 1.5339 |
InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 | |||
CC(=O)c1ccccc1 | |||
3-phenylpropan-1-ol | Hydrocinnamyl alcohol | C9H12O | 1.5357 |
InChI=1/C9H12O/c10-8-4-7-9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 | |||
OCCCc1ccccc1 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
p-Fluoroaniline | C6H6FN | 1.536 | |
Methyl salicylate | HOC6H4CO2CH3 | 1.5369 | |
Creosol | 3,4-CH3O(OH)C6H3CH3 | 1.537 | |
Ethylene bromide | BrCH2CH2Br | 1.5379 | |
Benzyl chloride | C7H7Cl | 1.539 | |
Methyl benzoylacetate | C10H10O3 | 1.5394 | |
Benzyl alcohol | C6H5CH2OH | 1.5399 | |
m-Cresol | C7H8O | 1.540 | |
p-Cresol | C7H8O | 1.540 | |
Benzal bromide | C6H5CHBr2 | 1.541 | |
Diethylaniline | C6H5N(C2H5)2 | 1.5421 | |
o-Nitrophenetol | o-C2H5OC6H4NO2 | 1.5425 | |
1,2-Acetylene dibromide | BrCHCHBr | 1.5437 | |
Benzylamine | C6H5CH2NH2 | 1.5440 | |
carbonothioyl dichloride | Thiophosgene | CCl2S | l.5442 |
InChI=1/CCl2S/c2-1(3)4 | |||
ClC(Cl)=S | |||
m-Fluoroaniline | C6H6FN | 1.5455 | |
m-Dichlorobenzene | C6H4Cl2 | 1.46 | |
o-Nitrotoluene | C7H7NO2 | 1.5462 | |
Benzaldehyde | C6H5CHO | 1.5464 | |
Dimethyl-p-toluidine | C9H13N | 1.5469 | |
o-Cresol | C7H8O | 1.547 | |
Iodomethyl methyl ether | ICH2OCH | 1.5472 | |
m-Nitrotoluene | C7H7NO2 | 1.5475 | |
4-Dimethylamino-m-xylene | C10H15N | 1.5481 | |
o-Dichlorobenzene | C6H4Cl2 | 1.549 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
p-Bromotoluene | C7H7Br | 1.5490 | |
Dimethyl-m-toluidine | C9H13N | 1.5492 | |
m-Bromotoluene | C7H7Br | 1.551 | |
2-Bromo-p-xylene | C8H9Br | 1.551 | |
nitrobenzene | Nitrobenzene | C6H5NO2 | 1.5529 |
InChI=1/C6H5NO2/c8-7(9)6-4-2-1-3-5-6/h1-5H | |||
O=N(=O)c1ccccc1 | |||
Benzoyl chloride | C6H5COCl | 1.5537 | |
o-Bromotoluene | C7H7Br | 1.555 | |
N-Ethylaniline | C6H5NHC2H5 | 1.5559 | |
4-Bromo-o-xylene | C8H9Br | 1.556 | |
Sorbic chloride | C6H7ClO | 1.5562 | |
3,5-Dimethylamline | C8H11N | 1.558 | |
1,2,3-Tribromopentane | C6H9Br3 | 1.559 | |
2,4-Dimethylamline | C8H11N | 1.559 | |
o-Methoxybenzaldehyde | C8H8O2 | 1.5597 | |
trans-Ethyl cinnamate | C11H12O2 | 1.5598 | |
Bromobenzene | C6H5Br | 1.560 | |
2,6-Dimethylamline | C8H11N | 1.561 | |
o-Nitroanisol | C7H7NO3 | 1.5620 | |
Methyl-o-toluidine | CH3C6H4NCH3 | 1.5649 | |
m-Chlorobenzaldehyde | C7H5ClO | 1.5650 | |
1,2,3-Tribromobutane | C4H7Br3 | 1.567 | |
o-Chlorobenzaldehyde | C7H5ClO | 1.567 | |
1,2,4-Trichlorobenzene | C6H3Cl3 | 1.5671 | |
o-Phthalyl dichloride | o-C6H4(COCl)2 | 1.5692 | |
2,3-Dimethylamline | C8H11N | 1.570 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
Methylaniline | C6H6NHCH3 | 1.5714 | |
o-Toluidine | o-CH3C6H4NH2 | 1.5728 | |
Salicyl aldehyde | o-HOC6H4CHO | 1.5735 | |
Isonicoteine | C10H12N2 | 1.5749 | |
ω-Phenylethylamine | C6H5CH2CH2NH2 | 1.575 | |
Dibenzylmethane | (C6H5CH2)2CH2 | 1.576 | |
1,1-Diphenylethane | (C6H5)2CHCH | 1.5761 | |
m-Bromochlorobenzene | C6H4BrCl | 1.577 | |
o-Bromochlorobenzene | C6H4BrCl | 1.5814 | |
1,1-Methylphenylhydrazine | C7H10N2 | 1.583 | |
1,2,3-Tribromopropane | C3H5Br3 | 1.584 | |
Anthranil | C7H6NO | 1.5861 | |
Aniline | C6H7N | 1.5863 | |
α-Bromostyrene | C6H6CBrCH2 | 1.588 | |
Dimethylaniline | C6H5N(CH3)2 | 1.5887 | |
Bromoform | CHBr3 | 1.589 | |
1,1,2-Tribromoethane | BrCH2CHBr2 | 1.5890 | |
o-Chloroaniline | C6H6ClN | 1.5895 | |
Diphenylacetaldehyde | C14H12O | 1.5921 | |
m-Chloroaniline | C6H6ClN | 1.5931 | |
m-Bromonitrobenzene | C6H4BrNO2 | 1.5979 | |
Tribromoethylene | Br2CCHBr | 1.5992 | |
Ethyl α-naphthyl ether | C12H12O | 1.602 | |
1,2,2-Tribromo-1-chloroethane | C2H2Br3Cl | 1.603 | |
1,2,2-Tribromo-1,2-dichloroethane | C2HBr3Cl2 | 1.6062 |
substance name | alternate name | formula | refractive index |
---|---|---|---|
InChI | |||
SMILES | |||
1,1,4,4-Tetrabromobutane | C4H6Br4 | 1.6077 | |
m-Dibromobehzene | C6H4Br2 | 1.608 | |
Phenylhydrazine | C6H5NHNH2 | 1.6081 | |
o-Iodotoluene | C7H7I | 1.609 | |
ω-Bromostyrene (isomer 1) | C8H7Br | 1.6094 | |
o-Dibromobenzene | C6H4Br2 | 1.611 | |
7-Methylquinoline | C10H9N | 1.6149 | |
8-Methylquinoline | C10H9N | 1.616 | |
α-Methylnaphthalene | C11H10 | 1.618 | |
Cinnamic aldehyde | C6H5CHCHCHO | 1.6195 | |
Iodobenzene | C6H5I | 1.621 | |
m-Bromoaniline | C6H6BrN | 1.6260 | |
1,1,1,2-Tetrabromoethane | BrCH2CBr3 | 1.6277 | |
α-Chloronaphthalene | C10H7Cl | 1.633 | |
1,1,2,2-Tetrabromoethane | C2H2Br4 | 1.638 | |
1,3-Diiodopropane | ICH2CH2CH2I | 1.642 | |
Phenyl isothiocyanate | C6H5NCS | 1.6509 | |
α-Bromonaphthalene | C10H7Br | 1.658 | |
Diphenyl telluride | (C6H5)2Te | 1.6913 |
This site is in construction. More to come. Page was last modified on April 11 2011, 16:50:48.